For research use only. Not for therapeutic Use.
N-(2-Hydroxyethyl)methacrylamide(Cat No.:L006993), is a chemical compound widely used in the synthesis of polymers and copolymers for various applications. It contains a methacrylamide moiety with an additional hydroxyethyl group, enhancing its reactivity. This compound is a key monomer in the production of hydrogels, coatings, and adhesives due to its ability to form cross-linked networks, making it valuable in biomaterials and tissue engineering. Its presence in copolymers enhances their hydrophilicity and biocompatibility, making it essential in the development of materials for medical devices and drug delivery systems, contributing significantly to the field of biomaterials research.
CAS Number | 5238-56-2 |
Molecular Formula | C6H11NO2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | N-(2-hydroxyethyl)-2-methylprop-2-enamide |
InChI | InChI=1S/C6H11NO2/c1-5(2)6(9)7-3-4-8/h8H,1,3-4H2,2H3,(H,7,9) |
InChIKey | BSCJIBOZTKGXQP-UHFFFAOYSA-N |
SMILES | CC(=C)C(=O)NCCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |