Home
>
Chemical Reagents>Organic Building Blocks> N-((1S,2S)-2-Amino-1,2-bis(4-methoxyphenyl)ethyl)-4-methylbenzenesulfonamide
For research use only. Not for therapeutic Use.
N-((1S,2S)-2-Amino-1,2-bis(4-methoxyphenyl)ethyl)-4-methylbenzenesulfonamide (Cat.No:L003959) is a crucial compound in pharmaceutical research. Its unique structure, comprising an aminoethyl group and sulfonamide motif, grants it significant pharmacological potential. This compound is employed as a key building block in the synthesis of specialized pharmaceutical agents, particularly in the field of drug development.
| CAS Number | 887924-07-4 |
| Molecular Formula | C23H26N2O4S |
| Purity | ≥95% |
| IUPAC Name | N-[(1S,2S)-2-amino-1,2-bis(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide |
| InChI | InChI=1S/C23H26N2O4S/c1-16-4-14-21(15-5-16)30(26,27)25-23(18-8-12-20(29-3)13-9-18)22(24)17-6-10-19(28-2)11-7-17/h4-15,22-23,25H,24H2,1-3H3/t22-,23-/m0/s1 |
| InChIKey | QECIBWAUSHWNEP-GOTSBHOMSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](C2=CC=C(C=C2)OC)[C@H](C3=CC=C(C=C3)OC)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |