For research use only. Not for therapeutic Use.
N-(1-Methylethyl)-benzenemethanamine (Cat.No:M069823) is an organic compound with applications in the pharmaceutical and chemical industries. Also known as isopropylbenzylamine, it serves as a precursor in the synthesis of various pharmaceuticals and research chemicals. Its versatile structure makes it valuable for creating diverse molecules in chemical synthesis processes.
| CAS Number | 102-97-6 |
| Molecular Formula | C10H15N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-benzylpropan-2-amine |
| InChI | InChI=1S/C10H15N/c1-9(2)11-8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3 |
| InChIKey | LYBKPDDZTNUNNM-UHFFFAOYSA-N |
| SMILES | CC(C)NCC1=CC=CC=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
