For research use only. Not for therapeutic Use.
N-Feruloyloctopamine(CAT: R043089) is a phenolic amide formed from the conjugation of ferulic acid and octopamine, naturally occurring in various plants. It has attracted research interest for its antioxidant, anti-inflammatory, and neuroprotective properties. Studies suggest that N-Feruloyloctopamine can scavenge free radicals, modulate nitric oxide production, and regulate inflammatory signaling pathways, contributing to vascular and neuronal protection. Its structural link to phenylpropanoids and biogenic amines also makes it relevant in phytochemistry and natural product research. With potential applications in cardiovascular, metabolic, and neurodegenerative disease studies, N-Feruloyloctopamine represents a promising bioactive molecule for therapeutic exploration and functional food development.
| CAS Number | 66648-44-0 |
| Synonyms | (E)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| Molecular Formula | C18H19NO5 |
| Purity | ≥95% |
| IUPAC Name | (E)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| InChI | InChI=1S/C18H19NO5/c1-24-17-10-12(2-8-15(17)21)3-9-18(23)19-11-16(22)13-4-6-14(20)7-5-13/h2-10,16,20-22H,11H2,1H3,(H,19,23)/b9-3+ |
| InChIKey | VJSCHQMOTSXAKB-YCRREMRBSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)NCC(C2=CC=C(C=C2)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
