For research use only. Not for therapeutic Use.
Myrianthic acid is a natural triterpene compound isolated from the bark of Myrianthus arboreus, a tropical tree. This bioactive molecule exhibits antimalarial properties and has been studied for its potential in combating malaria parasites. Myrianthic acid’s mechanism of action involves disrupting essential cellular processes in the malaria parasite, making it a promising lead compound for antimalarial drug development. Ongoing research aims to optimize its efficacy, bioavailability, and safety profile for use in malaria treatment. Myrianthic acid represents a valuable natural product with therapeutic potential against infectious diseases like malaria.
| CAS Number | 89786-84-5 |
| Molecular Formula | C30H48O6 |
| Purity | ≥95% |
| Target | Plants |
| Storage | Store at +4C |
| IUPAC Name | (1R,2R,4aS,6aR,6aS,6bR,8aR,9R,10S,11R,12aR,14bS)-1,10,11-trihydroxy-9-(hydroxymethyl)-1,2,6a,6b,9,12a-hexamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| InChI | InChI=1S/C30H48O6/c1-17-9-12-30(24(34)35)14-13-27(4)18(22(30)29(17,6)36)7-8-21-25(2)15-19(32)23(33)26(3,16-31)20(25)10-11-28(21,27)5/h7,17,19-23,31-33,36H,8-16H2,1-6H3,(H,34,35)/t17-,19-,20-,21-,22-,23-,25+,26+,27-,28-,29-,30+/m1/s1 |
| InChIKey | YCOKATFNRPZIIU-MGBZEVKYSA-N |
| SMILES | CC1CCC2(CCC3(C(=CCC4C3(CCC5C4(CC(C(C5(C)CO)O)O)C)C)C2C1(C)O)C)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |