For research use only. Not for therapeutic Use.
Murrayone(CAT: M013443) is a naturally occurring carbazole alkaloid isolated from plants of the Murraya genus, commonly used in traditional medicine. It features a tricyclic aromatic carbazole scaffold, a structure known for diverse biological activities. Preliminary studies have indicated that murrayone may possess antimicrobial, antioxidant, and cytotoxic properties, making it of interest in cancer and infection-related research. As with other carbazole alkaloids, its bioactivity is linked to its ability to interact with cellular enzymes and signaling pathways. Murrayone is primarily studied in phytochemistry, pharmacognosy, and medicinal chemistry as a potential lead compound for novel therapeutic development.
| CAS Number | 19668-69-0 |
| Synonyms | 7-methoxy-8-(3-methyl-2-oxobut-3-enyl)chromen-2-one |
| Molecular Formula | C15H14O4 |
| Purity | ≥95% |
| IUPAC Name | 7-methoxy-8-(3-methyl-2-oxobut-3-enyl)chromen-2-one |
| InChI | InChI=1S/C15H14O4/c1-9(2)12(16)8-11-13(18-3)6-4-10-5-7-14(17)19-15(10)11/h4-7H,1,8H2,2-3H3 |
| InChIKey | IISMOXLSZASLDD-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)CC1=C(C=CC2=C1OC(=O)C=C2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
