For research use only. Not for therapeutic Use.
MuRF1-IN-2 (CAT: I040647) is a selective small-molecule inhibitor of MuRF1 (Muscle RING-Finger Protein-1), an E3 ubiquitin ligase involved in the ubiquitin-proteasome pathway that mediates muscle protein degradation. By targeting MuRF1, MuRF1-IN-2 offers a promising approach for studying the molecular mechanisms of muscle atrophy, particularly in conditions such as sarcopenia, cachexia, and cardiac muscle wasting. This compound is valuable in research aimed at preserving skeletal and cardiac muscle mass and function under catabolic stress or disease conditions. MuRF1-IN-2 supports preclinical investigation into therapeutic strategies against muscle wasting disorders.
| CAS Number | 937891-74-2 |
| Synonyms | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoate |
| Molecular Formula | C23H22N2O7 |
| Purity | ≥95% |
| IUPAC Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzoate |
| InChI | InChI=1S/C23H22N2O7/c1-13-10-20(26)32-19-11-17(8-9-18(13)19)30-12-15-4-6-16(7-5-15)22(28)31-14(2)21(27)25-23(29)24-3/h4-11,14H,12H2,1-3H3,(H2,24,25,27,29) |
| InChIKey | QPLWJVFJFYAMHG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OCC3=CC=C(C=C3)C(=O)OC(C)C(=O)NC(=O)NC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
