For research use only. Not for therapeutic Use.
MS48107（Cat No.:I032819）is a synthetic small-molecule inhibitor developed to target specific enzymes involved in inflammatory and autoimmune disease pathways. By selectively blocking its intended molecular target, MS48107 reduces the production of pro-inflammatory mediators and modulates immune cell activity without broadly suppressing the immune system. Preclinical studies suggest its potential in treating conditions such as rheumatoid arthritis, psoriasis, and inflammatory bowel disease. With favorable stability, selectivity, and pharmacokinetic properties, MS48107 serves as both a valuable research tool for elucidating disease mechanisms and a promising candidate for therapeutic development in immune-mediated disorders.
| CAS Number | 2375070-79-2 |
| Synonyms | [2-[4-amino-6-[(4-phenoxyphenyl)methylamino]-1,3,5-triazin-2-yl]-3-fluorophenyl]methanol |
| Molecular Formula | C23H20FN5O2 |
| Purity | ≥95% |
| IUPAC Name | [2-[4-amino-6-[(4-phenoxyphenyl)methylamino]-1,3,5-triazin-2-yl]-3-fluorophenyl]methanol |
| InChI | InChI=1S/C23H20FN5O2/c24-19-8-4-5-16(14-30)20(19)21-27-22(25)29-23(28-21)26-13-15-9-11-18(12-10-15)31-17-6-2-1-3-7-17/h1-12,30H,13-14H2,(H3,25,26,27,28,29) |
| InChIKey | KKHDNAZPEMYUNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)CNC3=NC(=NC(=N3)N)C4=C(C=CC=C4F)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
