For research use only. Not for therapeutic Use.
MRTX9768（Cat No.:I032790）is a potent, selective inhibitor of PRMT5 (protein arginine methyltransferase 5), designed to exploit vulnerabilities in MTAP-deleted cancers. It targets the PRMT5–MTA complex, which is prevalent in tumors with MTAP loss, and covalently binds to PRMT5 to block symmetric arginine dimethylation. This action disrupts oncogenic gene expression and halts tumor cell proliferation. MRTX9768 shows strong antitumor efficacy and favorable pharmacological properties in preclinical models. It represents a promising therapeutic strategy for precision oncology, particularly in malignancies such as gliomas and non-small cell lung cancers with MTAP deletions.
| CAS Number | 2629314-68-5 |
| Synonyms | 2-[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-2-methylpyrazol-3-yl]-3-fluoronaphthalene-1-carbonitrile |
| Molecular Formula | C24H17FN6O |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[4-(aminomethyl)-1-oxo-2H-phthalazin-6-yl]-2-methylpyrazol-3-yl]-3-fluoronaphthalene-1-carbonitrile |
| InChI | InChI=1S/C24H17FN6O/c1-31-23(22-18(10-26)15-5-3-2-4-13(15)9-20(22)25)19(12-28-31)14-6-7-16-17(8-14)21(11-27)29-30-24(16)32/h2-9,12H,11,27H2,1H3,(H,30,32) |
| InChIKey | BPTYWAYMKBEXES-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C2=CC3=C(C=C2)C(=O)NN=C3CN)C4=C(C5=CC=CC=C5C=C4F)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
