For research use only. Not for therapeutic Use.
MRT-81(Cat No.:I045143)is an investigational small-molecule inhibitor targeting MDM2, a negative regulator of the tumor suppressor protein p53. By disrupting the MDM2–p53 interaction, MRT-81 stabilizes and activates p53, leading to cell cycle arrest and apoptosis in cancer cells with wild-type p53. It is being studied for its potential in treating various malignancies, including leukemia and solid tumors, where p53 pathway reactivation may restore tumor-suppressive function. MRT-81 offers a promising approach in precision oncology. Supplied for research into p53 signaling, cancer biology, and targeted anti-cancer drug development.
| CAS Number | 1263132-08-6 |
| Synonyms | 3,4,5-trimethoxy-N-[[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamothioyl]benzamide |
| Molecular Formula | C31H29N3O5S |
| Purity | ≥95% |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-methyl-3-[(4-phenylbenzoyl)amino]phenyl]carbamothioyl]benzamide |
| InChI | InChI=1S/C31H29N3O5S/c1-19-10-15-24(32-31(40)34-30(36)23-16-26(37-2)28(39-4)27(17-23)38-3)18-25(19)33-29(35)22-13-11-21(12-14-22)20-8-6-5-7-9-20/h5-18H,1-4H3,(H,33,35)(H2,32,34,36,40) |
| InChIKey | CTXQODCQOSYYDE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=S)NC(=O)C2=CC(=C(C(=C2)OC)OC)OC)NC(=O)C3=CC=C(C=C3)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |