For research use only. Not for therapeutic Use.
MRS1334（Cat No.:M042767）is a potent and selective antagonist of the human adenosine A₃ receptor (hA₃R), exhibiting a Ki of 2.69 nM, with significantly lower affinity for rat A₁ and A₂A receptors (Ki >100 nM) . Its high selectivity makes it a valuable tool in pharmacological research, particularly in studying A₃R-mediated physiological and pathological processes. MRS1334 has been shown to block the protective effects of A₃R agonists like Cl-IB-MECA, leading to physiological changes such as bradycardia and elevated ST segments in experimental models . Additionally, MRS1334 contains an alkyne group, enabling its use in click chemistry applications for molecular labeling and tracking.
| CAS Number | 192053-05-7 |
| Synonyms | 3-O-ethyl 5-O-[(4-nitrophenyl)methyl] 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Formula | C31H26N2O6 |
| Purity | ≥95% |
| IUPAC Name | 3-O-ethyl 5-O-[(4-nitrophenyl)methyl] 2-methyl-6-phenyl-4-(2-phenylethynyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | InChI=1S/C31H26N2O6/c1-3-38-30(34)27-21(2)32-29(24-12-8-5-9-13-24)28(26(27)19-16-22-10-6-4-7-11-22)31(35)39-20-23-14-17-25(18-15-23)33(36)37/h4-15,17-18,26,32H,3,20H2,1-2H3 |
| InChIKey | QFLOJAMZLQXHFS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C#CC2=CC=CC=C2)C(=O)OCC3=CC=C(C=C3)[N+](=O)[O-])C4=CC=CC=C4)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
