For research use only. Not for therapeutic Use.
MRK-740（Cat No.:I015050）is a potent, selective inhibitor of protein arginine methyltransferase 5 (PRMT5), an enzyme that symmetrically dimethylates arginine residues on histones and non-histone proteins. By blocking PRMT5 activity, MRK-740 modulates transcription, RNA splicing, and cellular proliferation pathways. Unlike traditional inhibitors, MRK-740 binds covalently to the SAM-binding pocket, offering high target selectivity. Preclinical studies show anti-proliferative effects in cancer models, highlighting its potential in oncology research. MRK-740 serves as a valuable chemical probe for dissecting PRMT5 biology and exploring therapeutic strategies targeting epigenetic regulation.
| CAS Number | 2387510-80-5 |
| Synonyms | 3-(3,5-dimethoxyphenyl)-5-[1-methyl-9-(2-methylpyridin-4-yl)-1,4,9-triazaspiro[5.5]undecan-4-yl]-1,2,4-oxadiazole |
| Molecular Formula | C25H32N6O3 |
| Purity | ≥95% |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-5-[1-methyl-9-(2-methylpyridin-4-yl)-1,4,9-triazaspiro[5.5]undecan-4-yl]-1,2,4-oxadiazole |
| InChI | InChI=1S/C25H32N6O3/c1-18-13-20(5-8-26-18)30-9-6-25(7-10-30)17-31(12-11-29(25)2)24-27-23(28-34-24)19-14-21(32-3)16-22(15-19)33-4/h5,8,13-16H,6-7,9-12,17H2,1-4H3 |
| InChIKey | NZYTZRHHBAJPKN-UHFFFAOYSA-N |
| SMILES | CC1=NC=CC(=C1)N2CCC3(CC2)CN(CCN3C)C4=NC(=NO4)C5=CC(=CC(=C5)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
