For research use only. Not for therapeutic Use.
MRIA9（Cat No.:I044432）is a potent and selective small-molecule inhibitor of salt-inducible kinases (SIKs), particularly SIK2 and SIK3, members of the AMP-activated protein kinase (AMPK) family involved in metabolic regulation, inflammation, and cancer. By inhibiting SIK activity, MRIA9 modulates the phosphorylation of downstream targets such as class IIa histone deacetylases (HDACs), thereby altering gene expression related to cell survival and immune response. It has demonstrated antiproliferative effects in preclinical cancer models and is valuable for studying SIK-dependent signaling pathways. MRIA9 supports therapeutic exploration in oncology, metabolic disorders, and inflammatory diseases.
| CAS Number | 2750707-05-0 |
| Synonyms | 8-[(5-amino-1,3-dioxan-2-yl)methyl]-6-[2-chloro-4-(3-fluoropyridin-2-yl)phenyl]-2-(methylamino)pyrido[2,3-d]pyrimidin-7-one |
| Molecular Formula | C24H22ClFN6O3 |
| Purity | ≥95% |
| IUPAC Name | 8-[(5-amino-1,3-dioxan-2-yl)methyl]-6-[2-chloro-4-(3-fluoropyridin-2-yl)phenyl]-2-(methylamino)pyrido[2,3-d]pyrimidin-7-one |
| InChI | InChI=1S/C24H22ClFN6O3/c1-28-24-30-9-14-7-17(16-5-4-13(8-18(16)25)21-19(26)3-2-6-29-21)23(33)32(22(14)31-24)10-20-34-11-15(27)12-35-20/h2-9,15,20H,10-12,27H2,1H3,(H,28,30,31) |
| InChIKey | QKNBRNSGPNCARD-UHFFFAOYSA-N |
| SMILES | CNC1=NC=C2C=C(C(=O)N(C2=N1)CC3OCC(CO3)N)C4=C(C=C(C=C4)C5=C(C=CC=N5)F)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
