For research use only. Not for therapeutic Use.
MrgprX2 antagonist-2（Cat No.:I045164）is a potent and selective blocker of the Mas-related G protein-coupled receptor X2 (MrgprX2), which is predominantly expressed on mast cells and involved in non-IgE-mediated hypersensitivity reactions. By inhibiting MrgprX2 activation, it prevents mast cell degranulation and the release of histamine and inflammatory mediators, thereby reducing pseudo-allergic and drug-induced reactions. This compound is a valuable research tool for elucidating MrgprX2’s role in immune regulation, allergic responses, and chronic inflammation, with potential therapeutic applications in mast cell–mediated disorders without impairing protective immune functions.
| CAS Number | 2642346-30-1 |
| Synonyms | 3-[4-(3,5-difluorophenoxy)pyridin-2-yl]-1-ethyl-1-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]urea |
| Molecular Formula | C17H16F5N3O3 |
| Purity | ≥95% |
| IUPAC Name | 3-[4-(3,5-difluorophenoxy)pyridin-2-yl]-1-ethyl-1-[(2R)-3,3,3-trifluoro-2-hydroxypropyl]urea |
| InChI | InChI=1S/C17H16F5N3O3/c1-2-25(9-14(26)17(20,21)22)16(27)24-15-8-12(3-4-23-15)28-13-6-10(18)5-11(19)7-13/h3-8,14,26H,2,9H2,1H3,(H,23,24,27)/t14-/m1/s1 |
| InChIKey | LLDJFKRONQQBRH-CQSZACIVSA-N |
| SMILES | CCN(C[C@H](C(F)(F)F)O)C(=O)NC1=NC=CC(=C1)OC2=CC(=CC(=C2)F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
