For research use only. Not for therapeutic Use.
MPT0G211（Cat No.:I044379）is a potent and selective histone deacetylase 6 (HDAC6) inhibitor with promising anticancer properties. By targeting HDAC6, MPT0G211 disrupts the deacetylation of non-histone proteins such as α-tubulin and Hsp90, affecting protein trafficking and stress responses in cancer cells. It induces apoptosis and inhibits proliferation, particularly in hematologic malignancies and solid tumors. Unlike pan-HDAC inhibitors, MPT0G211 offers greater specificity and reduced toxicity, making it suitable for combination therapies. Its ability to modulate cancer cell signaling and immune response makes it a valuable agent in epigenetic cancer research.
| CAS Number | 2151853-97-1 |
| Synonyms | N-hydroxy-4-[(quinolin-8-ylamino)methyl]benzamide |
| Molecular Formula | C17H15N3O2 |
| Purity | ≥95% |
| IUPAC Name | N-hydroxy-4-[(quinolin-8-ylamino)methyl]benzamide |
| InChI | InChI=1S/C17H15N3O2/c21-17(20-22)14-8-6-12(7-9-14)11-19-15-5-1-3-13-4-2-10-18-16(13)15/h1-10,19,22H,11H2,(H,20,21) |
| InChIKey | BPDQUKCPNSRTTR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)NCC3=CC=C(C=C3)C(=O)NO)N=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
