For research use only. Not for therapeutic Use.
MPT0B390（Cat No.:I044016）is a small molecule compound under investigation for its potential therapeutic applications, particularly in oncology. It functions as a selective inhibitor targeting key molecular pathways involved in tumor growth, survival, and metastasis. By modulating specific proteins or kinases, MPT0B390 aims to disrupt the proliferation and spread of cancer cells. Its mechanism of action suggests that it may be effective in treating various cancers, including solid tumors. Currently, MPT0B390 is being studied in preclinical and clinical trials to evaluate its safety, efficacy, and potential as a targeted cancer therapy.
| CAS Number | 1817802-18-8 |
| Synonyms | (E)-N-hydroxy-3-[1-(4-methoxyphenyl)sulfonyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide |
| Molecular Formula | C17H17N3O5S |
| Purity | ≥95% |
| IUPAC Name | (E)-N-hydroxy-3-[1-(4-methoxyphenyl)sulfonyl-2,3-dihydropyrrolo[2,3-b]pyridin-5-yl]prop-2-enamide |
| InChI | InChI=1S/C17H17N3O5S/c1-25-14-3-5-15(6-4-14)26(23,24)20-9-8-13-10-12(11-18-17(13)20)2-7-16(21)19-22/h2-7,10-11,22H,8-9H2,1H3,(H,19,21)/b7-2+ |
| InChIKey | QPXOAQWHONRALN-FARCUNLSSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)N2CCC3=C2N=CC(=C3)/C=C/C(=O)NO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
