For research use only. Not for therapeutic Use.
MPO-IN-3（Cat No.:I045160）is a potent, selective inhibitor of myeloperoxidase (MPO), an enzyme abundant in neutrophils that catalyzes the production of reactive oxidants such as hypochlorous acid. By blocking MPO activity, MPO-IN-3 reduces oxidative stress, inflammation, and tissue damage associated with conditions like cardiovascular diseases, neurodegenerative disorders, and chronic inflammatory states. Its high specificity minimizes off-target effects, making it a valuable tool for studying MPO-related pathways. MPO-IN-3 holds therapeutic potential for diseases driven by excessive MPO-mediated oxidative injury, supporting both biomedical research and drug development efforts targeting inflammatory pathologies.
| CAS Number | 1435469-45-6 |
| Synonyms | 1-(4-aminobutyl)-6-(2,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride |
| Molecular Formula | C16H22ClN3O3S |
| Purity | ≥95% |
| IUPAC Name | 1-(4-aminobutyl)-6-(2,4-dimethoxyphenyl)-2-sulfanylidenepyrimidin-4-one;hydrochloride |
| InChI | InChI=1S/C16H21N3O3S.ClH/c1-21-11-5-6-12(14(9-11)22-2)13-10-15(20)18-16(23)19(13)8-4-3-7-17;/h5-6,9-10H,3-4,7-8,17H2,1-2H3,(H,18,20,23);1H |
| InChIKey | VSIRCLPNEYEPPU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C2=CC(=O)NC(=S)N2CCCCN)OC.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
