For research use only. Not for therapeutic Use.
Moringin(CAT: I041634) is a naturally occurring isothiocyanate derived from the enzymatic hydrolysis of glucomoringin, a glucosinolate abundant in Moringa oleifera seeds. Structurally, it contains a benzyl isothiocyanate core with a β-D-glucopyranosyloxy group, giving it both lipophilic and hydrophilic properties. Moringin has attracted significant research interest for its potent antioxidant, anti-inflammatory, neuroprotective, and anticancer activities. Studies suggest it may modulate oxidative stress pathways, inhibit pro-inflammatory mediators, and induce apoptosis in certain cancer cells. Its multifunctional bioactivity positions it as a promising candidate for nutraceutical, pharmaceutical, and functional food applications, as well as a valuable compound in natural product and medicinal chemistry research.
| CAS Number | 73255-40-0 |
| Synonyms | (2S,3R,4R,5R,6S)-2-[4-(isothiocyanatomethyl)phenoxy]-6-methyloxane-3,4,5-triol |
| Molecular Formula | C14H17NO5S |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[4-(isothiocyanatomethyl)phenoxy]-6-methyloxane-3,4,5-triol |
| InChI | InChI=1S/C14H17NO5S/c1-8-11(16)12(17)13(18)14(19-8)20-10-4-2-9(3-5-10)6-15-7-21/h2-5,8,11-14,16-18H,6H2,1H3/t8-,11-,12+,13+,14-/m0/s1 |
| InChIKey | QAZIHHJTZPNRCM-CNJBRALLSA-N |
| SMILES | CC1C(C(C(C(O1)OC2=CC=C(C=C2)CN=C=S)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
