For research use only. Not for therapeutic Use.
Moracin P（Cat No.:M128272）is a naturally occurring stilbene derivative belonging to the benzofuran class, primarily found in the roots and bark of Morus species like Morus alba. It exhibits significant pharmacological properties, including anticancer, antioxidant, and anti-inflammatory activities. Moracin P has been shown to suppress tumor cell growth by inducing apoptosis and inhibiting pathways such as NF-κB and PI3K/Akt. Its antioxidant potential helps combat oxidative stress, while its antimicrobial activity broadens its therapeutic relevance. With its distinct polyphenolic structure, Moracin P holds promise for drug development targeting inflammation and cancer.
| CAS Number | 102841-46-3 |
| Synonyms | 5-[(6R)-6-hydroxy-7,7-dimethyl-5,6-dihydrofuro[3,2-g]chromen-2-yl]benzene-1,3-diol |
| Molecular Formula | C19H18O5 |
| Purity | ≥95% |
| IUPAC Name | 5-[(6R)-6-hydroxy-7,7-dimethyl-5,6-dihydrofuro[3,2-g]chromen-2-yl]benzene-1,3-diol |
| InChI | InChI=1S/C19H18O5/c1-19(2)18(22)7-11-3-10-6-15(23-16(10)9-17(11)24-19)12-4-13(20)8-14(21)5-12/h3-6,8-9,18,20-22H,7H2,1-2H3/t18-/m1/s1 |
| InChIKey | QFUCSEIKNTUPPA-GOSISDBHSA-N |
| SMILES | CC1([C@@H](CC2=C(O1)C=C3C(=C2)C=C(O3)C4=CC(=CC(=C4)O)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
