For research use only. Not for therapeutic Use.
Moracin O（Cat No.:M138939）is a bioactive benzofuran-type stilbene compound isolated from Morus species, particularly Morus alba (white mulberry). It exhibits a range of pharmacological activities, including potent antioxidant, anti-inflammatory, and anticancer effects. Moracin O has demonstrated the ability to inhibit cancer cell proliferation by inducing apoptosis and interfering with signaling pathways such as MAPK and PI3K/Akt. Additionally, it shows antimicrobial properties, making it a candidate for natural therapeutic development. Its unique polyphenolic structure supports its role in combating oxidative stress and modulating cellular responses in disease-related conditions.
| CAS Number | 123702-97-6 |
| Synonyms | 5-[(6R)-6-(2-hydroxypropan-2-yl)-5,6-dihydrofuro[3,2-f][1]benzofuran-2-yl]benzene-1,3-diol |
| Molecular Formula | C19H18O5 |
| Purity | ≥95% |
| IUPAC Name | 5-[(6R)-6-(2-hydroxypropan-2-yl)-5,6-dihydrofuro[3,2-f][1]benzofuran-2-yl]benzene-1,3-diol |
| InChI | InChI=1S/C19H18O5/c1-19(2,22)18-7-11-3-10-6-15(23-16(10)9-17(11)24-18)12-4-13(20)8-14(21)5-12/h3-6,8-9,18,20-22H,7H2,1-2H3/t18-/m1/s1 |
| InChIKey | HMTMYIWMPJSCAZ-GOSISDBHSA-N |
| SMILES | CC(C)([C@H]1CC2=C(O1)C=C3C(=C2)C=C(O3)C4=CC(=CC(=C4)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
