Mono-2-ethylhydroxyhexyl terephthalate (MEHHTP) is a plasticizer and a potential alternative to traditional phthalates in various applications. This compound enhances the flexibility and durability of polymers, making it suitable for use in flexible PVC, adhesives, and coatings. MEHHTP’s unique structure provides improved thermal stability and compatibility with different materials. Its reduced environmental and health impacts compared to conventional plasticizers make it an attractive option in sustainable manufacturing practices. Ongoing research aims to explore its full potential in industrial applications.
Catalog Number | R074727 |
CAS Number | 1684398-38-6 |
Synonyms | 1,4-Benzenedicarboxylic Acid 1-(2-Ethyl-5-hydroxyhexyl) Ester |
Molecular Formula | C₁₆H₂₂O₅ |
Purity | ≥95% |
Solubility | DMSO (Slightly), Methanol (Slightly) |
Appearance | Off-White to Light Red Solid |
Storage | -20°C Freezer, Under inert atmosphere |
InChI | 1S/C16H22O5/c1-3-12(5-4-11(2)17)10-21-16(20)14-8-6-13(7-9-14)15(18)19/h6-9,11-12,17H,3-5,10H2,1-2H3,(H,18,19) |
InChIKey | ODRKAFOVPBFSIN-UHFFFAOYSA-N |
SMILES | CCC(CCC(C)O)COC(=O)C1=CC=C(C=C1)C(=O)O |