For research use only. Not for therapeutic Use.
MMPI-1154（Cat No.:I015367）is a novel small-molecule antidepressant candidate that acts as a selective negative allosteric modulator of the metabotropic glutamate receptor 5 (mGluR5). By dampening excessive glutamatergic signaling, it shows rapid-acting antidepressant effects in preclinical models, positioning it as a potential alternative to traditional monoaminergic therapies. Unlike conventional antidepressants, MMPI-1154 demonstrates a faster onset of action, suggesting promise for treatment-resistant depression. Its mechanism highlights the therapeutic potential of targeting glutamate receptors in mood disorders. MMPI-1154 is under investigation for developing next-generation neuropsychiatric treatments.
| CAS Number | 1382722-47-5 |
| Synonyms | 2-[[(4-fluorophenyl)methyl-[(4-phenylmethoxyphenyl)methyl]amino]methyl]-1H-imidazole-5-carboxylic acid |
| Molecular Formula | C26H24FN3O3 |
| Purity | ≥95% |
| IUPAC Name | 2-[[(4-fluorophenyl)methyl-[(4-phenylmethoxyphenyl)methyl]amino]methyl]-1H-imidazole-5-carboxylic acid |
| InChI | InChI=1S/C26H24FN3O3/c27-22-10-6-19(7-11-22)15-30(17-25-28-14-24(29-25)26(31)32)16-20-8-12-23(13-9-20)33-18-21-4-2-1-3-5-21/h1-14H,15-18H2,(H,28,29)(H,31,32) |
| InChIKey | QLTNFRCPUOPISS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CN(CC3=CC=C(C=C3)F)CC4=NC=C(N4)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
