For research use only. Not for therapeutic Use.
MLS1547（Cat No.:I008116）is a small-molecule allosteric modulator that acts as a selective activator of the dopamine D2 receptor (D2R), specifically targeting the β-arrestin-biased signaling pathway. Unlike traditional D2R agonists that activate both G-protein and β-arrestin pathways, MLS1547 enhances β-arrestin recruitment while minimizing G-protein signaling. This signaling bias makes it a valuable tool for dissecting D2R-mediated pathways involved in neurological and psychiatric disorders. MLS1547 is used in studies exploring dopamine signaling, receptor pharmacology, and the development of next-generation antipsychotics and neurotherapeutics with reduced side effects.
| CAS Number | 315698-36-3 |
| Synonyms | 5-chloro-7-[(4-pyridin-2-ylpiperazin-1-yl)methyl]quinolin-8-ol |
| Molecular Formula | C19H19ClN4O |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-7-[(4-pyridin-2-ylpiperazin-1-yl)methyl]quinolin-8-ol |
| InChI | InChI=1S/C19H19ClN4O/c20-16-12-14(19(25)18-15(16)4-3-7-22-18)13-23-8-10-24(11-9-23)17-5-1-2-6-21-17/h1-7,12,25H,8-11,13H2 |
| InChIKey | OPEJNANYABTIGC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC(=C3C=CC=NC3=C2O)Cl)C4=CC=CC=N4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
