For research use only. Not for therapeutic Use.
ML401（Cat No.:I018167）is a selective small-molecule antagonist of the chemokine receptor CXCR4, a G protein–coupled receptor involved in immune cell trafficking, cancer metastasis, and HIV-1 entry. By blocking CXCR4–CXCL12 interactions, ML401 disrupts key signaling pathways that regulate cell migration, tumor progression, and viral infection. Research highlights its potential in oncology, immunology, and infectious disease studies. ML401 serves as a valuable probe for dissecting CXCR4-mediated processes, offering insights into therapeutic strategies for cancer, inflammatory disorders, and viral pathogenesis where CXCR4 plays a critical regulatory role.
| CAS Number | 1597489-14-9 |
| Synonyms | (E)-3-(4-bromophenyl)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
| Molecular Formula | C20H20BrClN2O |
| Purity | ≥95% |
| IUPAC Name | (E)-3-(4-bromophenyl)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]prop-2-en-1-one |
| InChI | InChI=1S/C20H20BrClN2O/c21-18-6-1-16(2-7-18)5-10-20(25)24-13-11-23(12-14-24)15-17-3-8-19(22)9-4-17/h1-10H,11-15H2/b10-5+ |
| InChIKey | NXTNVQJKGHAGAX-BJMVGYQFSA-N |
| SMILES | C1CN(CCN1CC2=CC=C(C=C2)Cl)C(=O)/C=C/C3=CC=C(C=C3)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
