For research use only. Not for therapeutic Use.
ML381(Cat No.:I008106)is a selective small molecule inhibitor of the NLRP3 inflammasome, a key component of the innate immune system that plays a role in inflammation and various inflammatory diseases. By inhibiting NLRP3 activation, ML381 is being investigated for its potential to treat conditions associated with excessive inflammation, including autoimmune diseases, neuroinflammation, and metabolic disorders. The compound is of interest in research focused on modulating the immune response to reduce tissue damage and improve disease outcomes. Ongoing studies aim to assess its efficacy and safety in preclinical models and its potential for clinical applications.
| CAS Number | 1623481-80-0 |
| Synonyms | 5-[(3-acetylphenoxy)methyl]-N-methyl-N-[(1S)-1-pyridin-2-ylethyl]-1,2-oxazole-3-carboxamide |
| Molecular Formula | C21H21N3O4 |
| Purity | ≥95% |
| IUPAC Name | 5-[(3-acetylphenoxy)methyl]-N-methyl-N-[(1S)-1-pyridin-2-ylethyl]-1,2-oxazole-3-carboxamide |
| InChI | InChI=1S/C21H21N3O4/c1-14(19-9-4-5-10-22-19)24(3)21(26)20-12-18(28-23-20)13-27-17-8-6-7-16(11-17)15(2)25/h4-12,14H,13H2,1-3H3/t14-/m0/s1 |
| InChIKey | JMYDHMCYZKRDPD-AWEZNQCLSA-N |
| SMILES | C[C@@H](C1=CC=CC=N1)N(C)C(=O)C2=NOC(=C2)COC3=CC=CC(=C3)C(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |