For research use only. Not for therapeutic Use.
ML289（Cat No.:R032705）is a small-molecule inhibitor that selectively blocks the signaling of interleukin-17 receptor A (IL-17RA), a key mediator in pro-inflammatory immune responses. By disrupting IL-17RA activity, ML289 reduces downstream cytokine release and immune cell activation, making it a valuable probe for studying autoimmune and inflammatory diseases. It has been used in research on conditions such as psoriasis, rheumatoid arthritis, and multiple sclerosis, where IL-17 signaling is pathogenic. ML289’s selectivity provides insights into IL-17 biology and supports therapeutic exploration of targeted immune modulation strategies.
| CAS Number | 1382481-79-9 |
| Synonyms | [(3R)-3-(hydroxymethyl)piperidin-1-yl]-[4-[2-(4-methoxyphenyl)ethynyl]phenyl]methanone |
| Molecular Formula | C22H23NO3 |
| Purity | ≥95% |
| IUPAC Name | [(3R)-3-(hydroxymethyl)piperidin-1-yl]-[4-[2-(4-methoxyphenyl)ethynyl]phenyl]methanone |
| InChI | InChI=1S/C22H23NO3/c1-26-21-12-8-18(9-13-21)5-4-17-6-10-20(11-7-17)22(25)23-14-2-3-19(15-23)16-24/h6-13,19,24H,2-3,14-16H2,1H3/t19-/m1/s1 |
| InChIKey | VSLWUPHHCFQTDB-LJQANCHMSA-N |
| SMILES | COC1=CC=C(C=C1)C#CC2=CC=C(C=C2)C(=O)N3CCC[C@H](C3)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
