For research use only. Not for therapeutic Use.
ML089（Cat No.:I044098）is a selective small-molecule agonist of the G protein-coupled receptor GPR35, an orphan receptor implicated in immune regulation, inflammation, and gastrointestinal homeostasis. By activating GPR35, ML089 modulates downstream signaling pathways such as β-arrestin recruitment and ERK phosphorylation, making it a valuable pharmacological tool for studying GPR35 function in various physiological and pathological contexts. ML089 is commonly used in inflammation, metabolic disease, and immune response research, particularly in relation to inflammatory bowel disease (IBD) and cardiovascular function. It supports drug discovery efforts targeting GPCR-mediated immunomodulation and tissue-specific signaling.
| CAS Number | 1306638-12-9 |
| Synonyms | 5-fluoro-2-phenyl-1,2-benzothiazol-3-one |
| Molecular Formula | C13H8FNOS |
| Purity | ≥95% |
| IUPAC Name | 5-fluoro-2-phenyl-1,2-benzothiazol-3-one |
| InChI | InChI=1S/C13H8FNOS/c14-9-6-7-12-11(8-9)13(16)15(17-12)10-4-2-1-3-5-10/h1-8H |
| InChIKey | ZTQXZKHEMCRFEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=C(S2)C=CC(=C3)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
