For research use only. Not for therapeutic Use.
ML RR-S2 CDA (CAT: I002133) is a synthetic CDN-derivative molecule that exhibits enhanced stability and lipophilicity compared to endogenous and pathogen-derived CDNs. This compound holds promise for anticancer clinical development as it promotes increased STING (Stimulator of Interferon Genes) signal, which activates the immune response against cancer cells. By improving the activation of the STING pathway, ML RR-S2 CDA may enhance immune recognition and elimination of cancer cells. However, further research is needed to fully understand its pharmacological activity, specific applications, and target information.
| CAS Number | 1638241-89-0 |
| Synonyms | ML RR-S2 CDA; STING-Inducer-1 |
| Molecular Formula | C20H24N10O10P2S2 |
| Purity | ≥95% |
| Target | STING |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| InChIKey | IZJJFUQKKZFVLH-LTKSHMRXSA-N |
| SMILES | C1C2C(C(C(O2)N3C=NC4=C3N=CN=C4N)OP(=S)(OCC5C(C(C(O5)N6C=NC7=C6N=CN=C7N)O)OP(=O)(O1)S)O)O |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |