For research use only. Not for therapeutic Use.
ML-184(Cat No.:I006130)is a selective and potent agonist of the GPR55 receptor, an orphan G protein-coupled receptor implicated in various physiological and pathological processes, including inflammation, pain, cancer, and bone metabolism. ML-184 activates GPR55-mediated signaling pathways without significantly affecting classical cannabinoid receptors CB1 and CB2, making it a valuable pharmacological tool for dissecting GPR55-specific functions. Researchers use ML-184 to study the receptor’s role in cellular proliferation, migration, and inflammatory responses. Its selectivity and efficacy support ongoing investigations into GPR55 as a potential therapeutic target in oncology and inflammatory diseases.
| CAS Number | 794572-10-4 |
| Synonyms | 3-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-N,N-dimethyl-4-pyrrolidin-1-ylbenzenesulfonamide |
| Molecular Formula | C25H34N4O3S |
| Purity | ≥95% |
| IUPAC Name | 3-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-N,N-dimethyl-4-pyrrolidin-1-ylbenzenesulfonamide |
| InChI | InChI=1S/C25H34N4O3S/c1-19-8-7-9-23(20(19)2)28-14-16-29(17-15-28)25(30)22-18-21(33(31,32)26(3)4)10-11-24(22)27-12-5-6-13-27/h7-11,18H,5-6,12-17H2,1-4H3 |
| InChIKey | VRSJAHQGJHDACS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N2CCN(CC2)C(=O)C3=C(C=CC(=C3)S(=O)(=O)N(C)C)N4CCCC4)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |