For research use only. Not for therapeutic Use.
MK6-83（Cat No.:R028305）is a potent and selective agonist of the transient receptor potential melastatin 8 (TRPM8) channel, a cold-sensing ion channel involved in thermoregulation, pain perception, and neuronal signaling. By activating TRPM8, MK6-83 induces calcium influx, making it a valuable tool for studying cold sensation pathways, neuropathic pain, and sensory neuron physiology. Researchers use MK6-83 to explore TRPM8’s role in nociception, inflammation, and potential therapeutic applications in pain management. Its specificity provides insights into TRP channel biology and aids in evaluating TRPM8 as a pharmacological target.
| CAS Number | 1062271-24-2 |
| Synonyms | 5-methyl-N-(2-piperidin-1-ylphenyl)thiophene-2-sulfonamide |
| Molecular Formula | C16H20N2O2S2 |
| Purity | ≥95% |
| IUPAC Name | 5-methyl-N-(2-piperidin-1-ylphenyl)thiophene-2-sulfonamide |
| InChI | InChI=1S/C16H20N2O2S2/c1-13-9-10-16(21-13)22(19,20)17-14-7-3-4-8-15(14)18-11-5-2-6-12-18/h3-4,7-10,17H,2,5-6,11-12H2,1H3 |
| InChIKey | IRGYSXZCDAWOOC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)S(=O)(=O)NC2=CC=CC=C2N3CCCCC3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
