For research use only. Not for therapeutic Use.
MK-0159(Cat No.:I043337)is a selective small-molecule inhibitor targeting the protein kinase, fibroblast growth factor receptor 1 (FGFR1), which plays a crucial role in cell signaling pathways involved in cell proliferation, differentiation, and survival. Overactivation of FGFR1 has been implicated in various cancers and genetic disorders. By inhibiting FGFR1, MK-0159 seeks to block aberrant signaling, potentially slowing tumor growth and reducing cancer progression. This compound is being studied for its therapeutic potential in treating cancers driven by FGFR1 mutations or dysregulation, particularly in non-small cell lung cancer and other FGFR1-dependent malignancies.
| CAS Number | 2641484-61-7 |
| Synonyms | N-[4-(2-methoxyethoxy)cyclohexyl]-6-(1,3-thiazol-5-yl)-1H-pyrrolo[2,3-b]pyridine-4-carboxamide |
| Molecular Formula | C20H24N4O3S |
| Purity | ≥95% |
| IUPAC Name | N-[4-(2-methoxyethoxy)cyclohexyl]-6-(1,3-thiazol-5-yl)-1H-pyrrolo[2,3-b]pyridine-4-carboxamide |
| InChI | InChI=1S/C20H24N4O3S/c1-26-8-9-27-14-4-2-13(3-5-14)23-20(25)16-10-17(18-11-21-12-28-18)24-19-15(16)6-7-22-19/h6-7,10-14H,2-5,8-9H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | JUVJFMVGYBBDKN-UHFFFAOYSA-N |
| SMILES | COCCOC1CCC(CC1)NC(=O)C2=CC(=NC3=C2C=CN3)C4=CN=CS4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |