For research use only. Not for therapeutic Use.
MitoPerOx(Cat No.:I043927)is a potent fluorescent probe designed to detect and quantify hydrogen peroxide (H₂O₂) levels specifically within the mitochondria. Due to its ability to target the mitochondrial matrix, MitoPerOx provides valuable insights into mitochondrial oxidative stress, a key factor in aging, neurodegenerative diseases, and various metabolic disorders. By allowing real-time monitoring of reactive oxygen species (ROS) in the mitochondria, MitoPerOx facilitates studies on cellular damage, signaling pathways, and disease mechanisms. Its high specificity and sensitivity make it a valuable tool for research into oxidative stress-related conditions and mitochondrial dysfunction.
| CAS Number | 1392820-50-6 |
| Molecular Formula | C42H38BBrF2N3OP |
| Purity | ≥95% |
| IUPAC Name | 2-[3-[2,2-difluoro-12-[(1E,3E)-4-phenylbuta-1,3-dienyl]-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-4-yl]propanoylamino]ethyl-triphenylphosphanium;bromide |
| InChI | InChI=1S/C42H37BF2N3OP.BrH/c44-43(45)47-35(18-14-13-17-34-15-5-1-6-16-34)25-27-37(47)33-38-28-26-36(48(38)43)29-30-42(49)46-31-32-50(39-19-7-2-8-20-39,40-21-9-3-10-22-40)41-23-11-4-12-24-41;/h1-28,33H,29-32H2;1H/b17-13+,18-14+; |
| InChIKey | UDTNTHFRCJAKLR-GPSHETCQSA-N |
| SMILES | [B-]1(N2C(=CC=C2CCC(=O)NCC[P+](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)C=C6[N+]1=C(C=C6)/C=C/C=C/C7=CC=CC=C7)(F)F.[Br-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |