For research use only. Not for therapeutic Use.
Mirificin(CAT: R072693) is a naturally occurring isoflavone glycoside, closely related to puerarin, and primarily found in Pueraria species such as Pueraria mirifica and Pueraria lobata (kudzu). It belongs to the class of phytoestrogens and exhibits diverse biological activities, including antioxidant, anti-inflammatory, and estrogenic effects. Mirificin has been studied for its potential in supporting cardiovascular health, bone metabolism, and hormone-related conditions. Due to its structural similarity to other bioactive isoflavones, it serves as a useful reference compound in natural product chemistry, nutraceutical research, and endocrine pharmacology. Mirificin is particularly valuable for exploring plant-derived compounds with therapeutic applications in metabolic and hormone-related disorders.
| CAS Number | 103654-50-8 |
| Synonyms | 8-[(2S,3R,4R,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]-7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| Molecular Formula | C26H28O13 |
| Purity | ≥95% |
| IUPAC Name | 8-[(2S,3R,4R,5S,6R)-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]-7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| InChI | InChI=1S/C26H28O13/c27-9-26(35)10-38-25(24(26)34)37-8-16-19(31)20(32)21(33)23(39-16)17-15(29)6-5-13-18(30)14(7-36-22(13)17)11-1-3-12(28)4-2-11/h1-7,16,19-21,23-25,27-29,31-35H,8-10H2/t16-,19-,20+,21-,23+,24+,25-,26-/m1/s1 |
| InChIKey | ZBXWGKPUSLRPHX-QOIVFALESA-N |
| SMILES | C1C(C(C(O1)OCC2C(C(C(C(O2)C3=C(C=CC4=C3OC=C(C4=O)C5=CC=C(C=C5)O)O)O)O)O)O)(CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
