For research use only. Not for therapeutic Use.
Milrinone(CAT: A000290) is a bipyridine phosphodiesterase 3 (PDE3) inhibitor (C₁₂H₉N₃O) used as a short-term intravenous therapy for acute decompensated heart failure. By inhibiting PDE3, it increases intracellular cyclic adenosine monophosphate (cAMP) levels, leading to enhanced myocardial contractility (positive inotropy) and vasodilation (afterload reduction). This dual action improves cardiac output and reduces ventricular filling pressures without significantly increasing myocardial oxygen demand. Milrinone has a relatively rapid onset and is particularly useful in patients unresponsive to conventional inotropes.
| CAS Number | 78415-72-2 |
| Synonyms | 78415-72-2; Primacor; Corotrope; Corotrop; Milrinona |
| Molecular Formula | C₁₂H₉N₃O |
| Purity | ≥95% |
| Target | Phosphodiesterase (PDE) |
| Solubility | >8.2mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | 6-methyl-2-oxo-5-pyridin-4-yl-1H-pyridine-3-carbonitrile |
| InChI | InChI=1S/C12H9N3O/c1-8-11(9-2-4-14-5-3-9)6-10(7-13)12(16)15-8/h2-6H,1H3,(H,15,16) |
| InChIKey | PZRHRDRVRGEVNW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=O)N1)C#N)C2=CC=NC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
