For research use only. Not for therapeutic Use.
Microhelenin C（Cat No.:I044912）is a naturally occurring secondary metabolite belonging to the class of polyketide-derived compounds, typically isolated from marine-derived fungi such as Microhelix species. It features a unique polyoxygenated structure with potential biological activity, including cytotoxic, antimicrobial, and antifungal properties. Microhelenin C is of particular interest in natural product chemistry and drug discovery due to its structural complexity and bioactive potential. Preliminary studies suggest it may interfere with cell proliferation and microbial viability, making it a promising candidate for further investigation in anticancer and anti-infective therapeutic development.
| CAS Number | 63569-07-3 |
| Synonyms | [(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (E)-2-methylbut-2-enoate |
| Molecular Formula | C20H26O5 |
| Purity | ≥95% |
| IUPAC Name | [(1S,3aR,5R,5aR,8aR,9S,9aR)-1,5,8a-trimethyl-2,8-dioxo-3a,4,5,5a,9,9a-hexahydro-1H-azuleno[6,5-b]furan-9-yl] (E)-2-methylbut-2-enoate |
| InChI | InChI=1S/C20H26O5/c1-6-10(2)18(22)25-17-16-12(4)19(23)24-14(16)9-11(3)13-7-8-15(21)20(13,17)5/h6-8,11-14,16-17H,9H2,1-5H3/b10-6+/t11-,12+,13+,14-,16-,17+,20+/m1/s1 |
| InChIKey | KUPPZVXLWANEJJ-YFVRYKHXSA-N |
| SMILES | C/C=C(\C)/C(=O)O[C@H]1[C@@H]2[C@@H](C(=O)O[C@@H]2C[C@H]([C@H]3[C@]1(C(=O)C=C3)C)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
