Microcystin-LA - CAS 96180-79-9

Microcystin-LA (Cat.No:R014035) is a naturally occurring cyanotoxin produced by certain freshwater cyanobacteria. It poses a significant threat to aquatic ecosystems and public health, as it can contaminate water bodies and cause harm to aquatic organisms and humans through ingestion, dermal contact, or inhalation of aerosolized water.

Catalog Number: R014035

CAS Number: 96180-79-9

Molecular Formula: C46H67N7O12

Molecular Weight:910.1

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

SynonymsCyanoginosin-LA;Toxin BE4 (Microcystis aeruginosa)

Property

Molecular Formula: C46H67N7O12
Molecular Weight910.1
Purity≥95%
Storage-20°C

Computed Descriptor

InChIInChI=1S/C46H67N7O12/c1-24(2)21-35-44(60)52-38(46(63)64)28(6)40(56)47-29(7)41(57)49-33(18-17-25(3)22-26(4)36(65-11)23-32-15-13-12-14-16-32)27(5)39(55)50-34(45(61)62)19-20-37(54)53(10)31(9)43(59)48-30(8)42(58)51-35/h12-18,22,24,26-30,33-36,38H,9,19-21
InChIKeyDIAQQISRBBDJIM-DRSCAGMXSA-N
SMILESCC(/C=C/[C@@H]([C@H](C)C(N[C@@H](C(O)=O)CCC(N(C)C(C(N[C@@H]1C)=O)=C)=O)=O)NC([C@H](C)NC([C@@]([H])(C)[C@H](C(O)=O)NC([C@]([H])(CC(C)C)NC1=O)=O)=O)=O)=C[C@@H]([C@H](CC2=CC=CC=C2)OC)C