Microcystin-LA (Cat.No:R014035) is a naturally occurring cyanotoxin produced by certain freshwater cyanobacteria. It poses a significant threat to aquatic ecosystems and public health, as it can contaminate water bodies and cause harm to aquatic organisms and humans through ingestion, dermal contact, or inhalation of aerosolized water.
Catalog Number | R014035 |
CAS Number | 96180-79-9 |
Synonyms | Cyanoginosin-LA;Toxin BE4 (Microcystis aeruginosa) |
Molecular Formula | C46H67N7O12 |
Purity | 95% |
Storage | -20°C |
InChI | InChI=1S/C46H67N7O12/c1-24(2)21-35-44(60)52-38(46(63)64)28(6)40(56)47-29(7)41(57)49-33(18-17-25(3)22-26(4)36(65-11)23-32-15-13-12-14-16-32)27(5)39(55)50-34(45(61)62)19-20-37(54)53(10)31(9)43(59)48-30(8)42(58)51-35/h12-18,22,24,26-30,33-36,38H,9,19-21 |
InChIKey | DIAQQISRBBDJIM-DRSCAGMXSA-N |
SMILES | CC(/C=C/[C@@H]([C@H](C)C(N[C@@H](C(O)=O)CCC(N(C)C(C(N[C@@H]1C)=O)=C)=O)=O)NC([C@H](C)NC([C@@]([H])(C)[C@H](C(O)=O)NC([C@]([H])(CC(C)C)NC1=O)=O)=O)=O)=C[C@@H]([C@H](CC2=CC=CC=C2)OC)C |
Reference | 1.Rinehart, K.L.,Harada, K.i.,Namikoshi, M., et al. Nodularin, microcystin, and the configuration of Adda. Journal of the American Chemical Society 110, 8557-8558 (1988). |