For research use only. Not for therapeutic Use.
MHY-1685（Cat No.:I045238）is a synthetic small-molecule autophagy activator that targets the AMP-activated protein kinase (AMPK) signaling pathway, enhancing cellular energy homeostasis and stress response. By stimulating AMPK, MHY-1685 promotes autophagic flux, facilitating the clearance of damaged organelles and aggregated proteins. This activity makes it a valuable research compound for studying metabolic regulation, neuroprotection, and age-related diseases. It has potential applications in investigating therapeutic strategies for conditions linked to impaired autophagy, such as neurodegenerative disorders, cardiovascular disease, and metabolic syndrome. Its mechanism offers insights into AMPK-dependent cellular maintenance and longevity pathways.
| CAS Number | 27406-31-1 |
| Synonyms | 5-[(4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| Molecular Formula | C11H8N2O4 |
| Purity | ≥95% |
| IUPAC Name | 5-[(4-hydroxyphenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| InChI | InChI=1S/C11H8N2O4/c14-7-3-1-6(2-4-7)5-8-9(15)12-11(17)13-10(8)16/h1-5,14H,(H2,12,13,15,16,17) |
| InChIKey | KSOJQSBHVKAHPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=C2C(=O)NC(=O)NC2=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
