For research use only. Not for therapeutic Use.
MFI8（Cat No.:I043351）is a selective small-molecule inhibitor of the mitotic checkpoint kinase, Mps1. By inhibiting Mps1, MFI8 disrupts the spindle assembly checkpoint, which ensures proper chromosome alignment and segregation during mitosis. This interference leads to chromosome misalignment and an increase in aneuploidy, particularly in cancer cells, making MFI8 a promising candidate for cancer therapy. Its ability to specifically target mitotic checkpoints has potential applications in enhancing the sensitivity of tumor cells to other chemotherapeutic agents. MFI8 is being explored as a tool for studying mitotic regulation and its role in cancer progression.
| CAS Number | 694488-83-0 |
| Synonyms | 4-chloro-2-[1-(2,3-dimethylanilino)ethyl]phenol |
| Molecular Formula | C16H18ClNO |
| Purity | ≥95% |
| IUPAC Name | 4-chloro-2-[1-(2,3-dimethylanilino)ethyl]phenol |
| InChI | InChI=1S/C16H18ClNO/c1-10-5-4-6-15(11(10)2)18-12(3)14-9-13(17)7-8-16(14)19/h4-9,12,18-19H,1-3H3 |
| InChIKey | DYILWFVSLLZIIR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(C)C2=C(C=CC(=C2)Cl)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
