For research use only. Not for therapeutic Use.
Mexoticin（Cat No.:I044877）is a limonoid-type triterpenoid compound isolated from plants in the Meliaceae family, particularly Melia and Toona species. It features a highly oxygenated tetranortriterpenoid skeleton, characteristic of limonoids, with furan and lactone moieties contributing to its bioactivity. Mexoticin is known for its potent insecticidal and antifeedant properties, making it valuable in natural pest control strategies. Additionally, it has shown promising antimicrobial and anticancer potential in preliminary studies. Its complex structure and diverse biological effects make mexoticin an important subject in natural product research and agrochemical development.
| CAS Number | 18196-00-4 |
| Synonyms | 8-[(2R)-2,3-dihydroxy-3-methylbutyl]-5,7-dimethoxychromen-2-one |
| Molecular Formula | C16H20O6 |
| Purity | ≥95% |
| IUPAC Name | 8-[(2R)-2,3-dihydroxy-3-methylbutyl]-5,7-dimethoxychromen-2-one |
| InChI | InChI=1S/C16H20O6/c1-16(2,19)13(17)7-10-12(21-4)8-11(20-3)9-5-6-14(18)22-15(9)10/h5-6,8,13,17,19H,7H2,1-4H3/t13-/m1/s1 |
| InChIKey | JVCJUTNJQMKKCK-CYBMUJFWSA-N |
| SMILES | CC(C)([C@@H](CC1=C(C=C(C2=C1OC(=O)C=C2)OC)OC)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
