For research use only. Not for therapeutic Use.
Metoxadiazone (Cat No.:C000717) is a chemical compound with potential applications in herbicide formulations. Its specific use and effects on plant growth or metabolism would depend on its mode of action. Research involving Metoxadiazone likely explores its herbicidal properties, interactions with plant biochemical pathways and its potential efficacy in weed control. The compound’s structure and reactivity may provide insights into its selectivity for target plants and its potential impact on non-target organisms or the environment.
| CAS Number | 60589-06-2 |
| Synonyms | 5-Methoxy-3-(2-methoxyphenyl)-1,3,4-oxadiazolin-2-one; 32861; Elemic; RP 32861; RPJ 168; S 21074; |
| Molecular Formula | C₁₀H₁₀N₂O₄ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | Pale Yellow to Light Brown Solid |
| Storage | -20°C, Inert atmosphere, Light sensitive |
| IUPAC Name | 5-methoxy-3-(2-methoxyphenyl)-1,3,4-oxadiazol-2-one |
| InChI | InChI=1S/C10H10N2O4/c1-14-8-6-4-3-5-7(8)12-10(13)16-9(11-12)15-2/h3-6H,1-2H3 |
| InChIKey | LTMQQEMGRMBUSL-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2C(=O)OC(=N2)OC |
| Reference | Ambrosi, D., et al.: BCPC Symp. Ser., 2, 533 (1979); |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |