For research use only. Not for therapeutic Use.
Metoprolol(Cat No.:I003845)is a beta-adrenergic blocker used to treat cardiovascular conditions such as hypertension, angina, and heart failure. It works by selectively blocking beta-1 receptors in the heart, reducing heart rate, cardiac output, and the demand for oxygen. This helps lower blood pressure, prevent angina attacks, and improve heart function in patients with chronic heart failure. Metoprolol is also used to reduce the risk of heart attacks and control abnormal heart rhythms. It is available in both immediate-release and extended-release forms, providing flexible dosing options for various cardiovascular needs.
| CAS Number | 51384-51-1 |
| Molecular Formula | C15H25NO3 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| IUPAC Name | 1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| InChI | InChI=1S/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3 |
| InChIKey | IUBSYMUCCVWXPE-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(COC1=CC=C(C=C1)CCOC)O |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |