For research use only. Not for therapeutic Use.
| CAS Number | 29112-40-1 |
| Synonyms | 4-[2-Hydroxy-3-[(1-methylethyl)amino]propoxy]benzeneacetic Acid Ethyl Ester;?[p-[2-Hydroxy-3-(isopropylamino)propoxy]phenyl]acetic Acid Ethyl Ester;?Ethyl 4-[2-Hydroxy-3-(isopropylamino)propoxy]phenylacetate |
| Molecular Formula | C16H25NO4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl 2-[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl]acetate |
| InChI | InChI=1S/C16H25NO4/c1-4-20-16(19)9-13-5-7-15(8-6-13)21-11-14(18)10-17-12(2)3/h5-8,12,14,17-18H,4,9-11H2,1-3H3 |
| InChIKey | ODIXSDYNGSUACV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC=C(C=C1)OCC(CNC(C)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |