For research use only. Not for therapeutic Use.
Methylsyringin（Cat No.:I044974）, also known as eleutheroside B, is a naturally occurring phenylpropanoid glycoside found in various medicinal plants such as Eleutherococcus senticosus and Syringa species. It exhibits a range of biological activities including antioxidant, anti-inflammatory, and neuroprotective effects. Methylsyringin is studied for its potential to modulate oxidative stress, enhance cognitive function, and support immune regulation. It also shows promise in cardiovascular and metabolic research. Due to its structural similarity to syringin, it plays a role in plant defense and secondary metabolism. Supplied at high purity, it is intended for pharmacological and biochemical research use only.
| CAS Number | 139742-20-4 |
| Synonyms | (2S,3R,4S,5S,6R)-2-[2,6-dimethoxy-4-[(E)-3-methoxyprop-1-enyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Formula | C18H26O9 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[2,6-dimethoxy-4-[(E)-3-methoxyprop-1-enyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI | InChI=1S/C18H26O9/c1-23-6-4-5-10-7-11(24-2)17(12(8-10)25-3)27-18-16(22)15(21)14(20)13(9-19)26-18/h4-5,7-8,13-16,18-22H,6,9H2,1-3H3/b5-4+/t13-,14-,15+,16-,18+/m1/s1 |
| InChIKey | KDZYNPVXUQIVAO-LSUNSJSKSA-N |
| SMILES | COC/C=C/C1=CC(=C(C(=C1)OC)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
