Home
>
Chemical Reagents>Organic Building Blocks> Methyl3,4-di[[(4-methylphenyl)sulfonyl]amino]benzoate
For research use only. Not for therapeutic Use.
Methyl 3,4-di[[(4-methylphenyl)sulfonyl]amino]benzoate(Cat No.:L007327), is a compound with versatile applications in the field of organic chemistry. Its molecular structure comprises a benzoate group attached to a benzene ring carrying two sulfonyl amino groups, each linked to a methyl phenyl moiety. This compound is commonly employed in the synthesis of complex organic molecules, serving as a key building block in various chemical transformations. Its sulfonamide functionality makes it valuable in medicinal chemistry, where it can be used as a precursor for the development of potential pharmaceutical agents. Researchers often utilize it in the design and synthesis of novel drug candidates due to its structural significance and reactivity.
| CAS Number | 181953-60-6 |
| Molecular Formula | C25H20F3NO4 |
| Purity | ≥95% |
| IUPAC Name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-(trifluoromethyl)phenyl]propanoic acid |
| InChI | InChI=1S/C25H20F3NO4/c26-25(27,28)16-7-5-6-15(12-16)22(13-23(30)31)29-24(32)33-14-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-12,21-22H,13-14H2,(H,29,32)(H,30,31) |
| InChIKey | YOGSOMNKKBEWAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC(=O)O)C4=CC(=CC=C4)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |