Home
>
Chemical Reagents>Organic Building Blocks> Methyl trans-4-Aminocyclohexanecarboxylate Hydrochloride
For research use only. Not for therapeutic Use.
Methyl trans-4-Aminocyclohexanecarboxylate Hydrochloride(CAT: L040979) is a crystalline, water-soluble salt featuring a methyl ester and an amino group in a trans-configuration on a cyclohexane ring. It is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and bioactive molecules, particularly in the preparation of chiral amine derivatives and peptidomimetics. The hydrochloride form enhances stability and handling, while the trans-stereochemistry imparts defined conformational behavior, beneficial in stereoselective synthesis. Its structure allows for straightforward functionalization through amidation or ester hydrolysis, making it a versatile building block in medicinal chemistry and chemical biology research for ligand, drug, and catalyst development.
| CAS Number | 61367-07-5 |
| Molecular Formula | C8H16ClNO2 |
| Purity | ≥95% |
| IUPAC Name | methyl 4-aminocyclohexane-1-carboxylate;hydrochloride |
| InChI | InChI=1S/C8H15NO2.ClH/c1-11-8(10)6-2-4-7(9)5-3-6;/h6-7H,2-5,9H2,1H3;1H |
| InChIKey | NHAYDXCUCXRAMF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC(CC1)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |