For research use only. Not for therapeutic Use.
Methyl sorbate (Cat No.:M047945) is the methyl ester of sorbic acid, commonly used as a preservative in food, beverages, and cosmetics due to its antimicrobial properties. It inhibits the growth of molds, yeasts, and some bacteria, making it effective in extending shelf life. Methyl sorbate is often preferred over sorbic acid for its improved solubility in various solvents and products. Additionally, it is used in the fragrance industry for its mild, fruity scent. The compound also finds applications in pharmaceuticals and agriculture for controlling microbial contamination in different formulations.
CAS Number | 1515-80-6 |
Synonyms | methyl (2E,4E)-hexa-2,4-dienoate |
Molecular Formula | C7H10O2 |
Purity | ≥95% |
IUPAC Name | methyl (2E,4E)-hexa-2,4-dienoate |
InChI | InChI=1S/C7H10O2/c1-3-4-5-6-7(8)9-2/h3-6H,1-2H3/b4-3+,6-5+ |
InChIKey | KWKVAGQCDSHWFK-VNKDHWASSA-N |
SMILES | C/C=C/C=C/C(=O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |