For research use only. Not for therapeutic Use.
Methyl mycophenolate(CAT: R004729) is the methyl ester derivative of mycophenolic acid (MPA), an immunosuppressive agent widely used in organ transplantation and autoimmune disease research. As a structural analog and metabolite-related compound, methyl mycophenolate is useful in pharmacology, drug metabolism, and medicinal chemistry studies. It provides a stable reference standard for investigating ester hydrolysis, prodrug design, and MPA-related metabolic pathways. Owing to its role in modulating inosine monophosphate dehydrogenase (IMPDH) activity through conversion to mycophenolic acid, methyl mycophenolate is a valuable reagent for exploring purine biosynthesis, immunomodulation, and the development of novel derivatives with improved bioavailability and pharmacokinetic profiles.
| CAS Number | 31858-66-9 |
| Molecular Formula | C18H22O6 |
| Purity | ≥95% |
| IUPAC Name | methyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| InChI | InChI=1S/C18H22O6/c1-10(6-8-14(19)22-3)5-7-12-16(20)15-13(9-24-18(15)21)11(2)17(12)23-4/h5,20H,6-9H2,1-4H3/b10-5+ |
| InChIKey | ZPXRQFLATDNYSS-BJMVGYQFSA-N |
| SMILES | CC1=C2COC(=O)C2=C(C(=C1OC)C/C=C(\C)/CCC(=O)OC)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
