Methyl Glyoxylate is a reactive aldehyde ester used in organic synthesis and biochemical research. It serves as a key intermediate in the production of various chemicals, pharmaceuticals, and agrochemicals. This compound is essential for studying chemical reactions, enzyme interactions, and metabolic pathways. Researchers and chemists rely on Methyl Glyoxylate for precise and reliable results in advanced synthetic methodologies and biochemical investigations, contributing significantly to innovations in chemical synthesis and metabolic research.
Catalog Number | R012586 |
CAS Number | 922-68-9 |
Synonyms | 2-Oxo-acetic Acid Methyl Ester; Methyl Oxoacetate; Oxoacetic Acid Methyl Ester; |
Molecular Formula | C3H4O3 |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | methyl 2-oxoacetate |
InChI | InChI=1S/C3H4O3/c1-6-3(5)2-4/h2H,1H3 |
InChIKey | KFKXSMSQHIOMSO-UHFFFAOYSA-N |
SMILES | COC(=O)C=O |