For research use only. Not for therapeutic Use.
Methyl carbamate（Cat No.:R070092）is an organic compound with the formula CH₃OCONH₂. It is a colorless, crystalline solid at room temperature and is soluble in water and many organic solvents. As a carbamate ester of methanol, it serves as a key intermediate in the synthesis of pesticides, pharmaceuticals, and polymers. Methyl carbamate is also studied for its role in producing urethane compounds and for its potential use as a protective group in organic synthesis. However, safety precautions are necessary due to its potential toxicity and suspected carcinogenicity in certain contexts.
| CAS Number | 598-55-0 |
| Synonyms | Methylurathane |
| Molecular Formula | C2H5NO2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | methyl carbamate |
| InChI | InChI=1S/C2H5NO2/c1-5-2(3)4/h1H3,(H2,3,4) |
| InChIKey | GTCAXTIRRLKXRU-UHFFFAOYSA-N |
| SMILES | COC(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
