For research use only. Not for therapeutic Use.
Methyl acrylate(CAT: R045180) is a volatile, colorless liquid ester with the chemical formula C₄H₆O₂, formed from acrylic acid and methanol. It is widely used as a reactive monomer in the production of acrylic polymers and copolymers, which are found in paints, adhesives, textiles, coatings, and plastics. Due to its vinyl double bond, methyl acrylate undergoes free-radical polymerization, allowing incorporation into diverse polymeric structures. It also serves as an intermediate in organic synthesis and pharmaceutical manufacturing. Methyl acrylate is flammable and has a sharp odor; it must be handled with care due to its potential toxicity and irritant properties.
| CAS Number | 96-33-3 |
| Synonyms | 2-Propenoic Acid Methyl Ester; Acrylic Acid Methyl Ester; Methoxycarbonylethylene; Methyl Acrylic Ester; Methyl Prop-2-enoate; Methyl Propenoate; NSC 24146 |
| Molecular Formula | C4H6O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | methyl prop-2-enoate |
| InChI | InChI=1S/C4H6O2/c1-3-4(5)6-2/h3H,1H2,2H3 |
| InChIKey | BAPJBEWLBFYGME-UHFFFAOYSA-N |
| SMILES | COC(=O)C=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
